C19H25NO3 — CID 111382254
2-[1-(4-ethoxyphenyl)ethylamino]-1-(3-methoxyphenyl)ethanol (PubChem CID 111382254) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-[1-(4-ethoxyphenyl)ethylamino]-1-(3-methoxyphenyl)ethanol.
| Compound Name | 2-[1-(4-ethoxyphenyl)ethylamino]-1-(3-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 111382254 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-[1-(4-ethoxyphenyl)ethylamino]-1-(3-methoxyphenyl)ethanol |
| SMILES | CCOc1ccc(C(C)NCC(O)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C19H25NO3/c1-4-23-17-10-8-15(9-11-17)14(2)20-13-19(21)16-6-5-7-18(12-16)22-3/h5-12,14,19-21H,4,13H2,1-3H3 |
| InChIKey | CGKIGSGQVDQATC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |