C13H21NO2 — CID 81373116
1-[[(1R)-1-(3-methoxyphenyl)ethyl]amino]butan-2-ol (PubChem CID 81373116) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-[[(1R)-1-(3-methoxyphenyl)ethyl]amino]butan-2-ol.
| Compound Name | 1-[[(1R)-1-(3-methoxyphenyl)ethyl]amino]butan-2-ol |
|---|---|
| PubChem CID | 81373116 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 1-[[(1R)-1-(3-methoxyphenyl)ethyl]amino]butan-2-ol |
| SMILES | CCC(O)CN[C@H](C)c1cccc(OC)c1 |
| InChI | InChI=1S/C13H21NO2/c1-4-12(15)9-14-10(2)11-6-5-7-13(8-11)16-3/h5-8,10,12,14-15H,4,9H2,1-3H3/t10-,12?/m1/s1 |
| InChIKey | NMHDJGPFOWYTCB-RWANSRKNSA-N |
| XLogP | 2.12 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |