C18H23NO3S — CID 98851139
(1S)-1-(3-methoxyphenyl)-2-[[(1S)-1-[4-[(S)-methylsulfinyl]phenyl]ethyl]amino]ethanol (PubChem CID 98851139) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is (1S)-1-(3-methoxyphenyl)-2-[[(1S)-1-[4-[(S)-methylsulfinyl]phenyl]ethyl]amino]ethanol.
| Compound Name | (1S)-1-(3-methoxyphenyl)-2-[[(1S)-1-[4-[(S)-methylsulfinyl]phenyl]ethyl]amino]ethanol |
|---|---|
| PubChem CID | 98851139 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (1S)-1-(3-methoxyphenyl)-2-[[(1S)-1-[4-[(S)-methylsulfinyl]phenyl]ethyl]amino]ethanol |
| SMILES | COc1cccc([C@H](O)CN[C@@H](C)c2ccc([S@](C)=O)cc2)c1 |
| InChI | InChI=1S/C18H23NO3S/c1-13(14-7-9-17(10-8-14)23(3)21)19-12-18(20)15-5-4-6-16(11-15)22-2/h4-11,13,18-20H,12H2,1-3H3/t13-,18+,23-/m0/s1 |
| InChIKey | AYPWJOHCIQKVNJ-PIPLOTLNSA-N |
| XLogP | 2.82 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |