C18H31ClN2O5 — CID 21389510
5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride (PubChem CID 21389510) has the molecular formula C18H31ClN2O5 and a molecular weight of 390.91 g/mol. Its IUPAC name is 5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride.
| Compound Name | 5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 21389510 |
| Molecular Formula | C18H31ClN2O5 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride |
| SMILES | CCC(CCC(C)NCC(O)c1ccc(O)c(C(N)=O)c1)(OC)OC.Cl |
| InChI | InChI=1S/C18H30N2O5.ClH/c1-5-18(24-3,25-4)9-8-12(2)20-11-16(22)13-6-7-15(21)14(10-13)17(19)23;/h6-7,10,12,16,20-22H,5,8-9,11H2,1-4H3,(H2,19,23);1H |
| InChIKey | BXUFTFBODVYLEE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|