About 5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride
5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride (PubChem CID 21389510) has the molecular formula C18H31ClN2O5
and a molecular weight of 390.91 g/mol. Its IUPAC name is 5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride.
Molecular Properties
| Compound Name | 5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride |
| PubChem CID | 21389510 |
| Molecular Formula | C18H31ClN2O5 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride |
| SMILES | CCC(CCC(C)NCC(O)c1ccc(O)c(C(N)=O)c1)(OC)OC.Cl |
| InChI | InChI=1S/C18H30N2O5.ClH/c1-5-18(24-3,25-4)9-8-12(2)20-11-16(22)13-6-7-15(21)14(10-13)17(19)23;/h6-7,10,12,16,20-22H,5,8-9,11H2,1-4H3,(H2,19,23);1H |
| InChIKey | BXUFTFBODVYLEE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride?
The IUPAC name of 5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride (CID 21389510) is 5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride.
What is the SMILES notation for 5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride?
The canonical SMILES for 5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride is CCC(CCC(C)NCC(O)c1ccc(O)c(C(N)=O)c1)(OC)OC.Cl.
What is the InChIKey of 5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride?
The InChIKey is BXUFTFBODVYLEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O5.ClH/c1-5-18(24-3,25-4)9-8-12(2)20-11-16(22)13-6-7-15(21)14(10-13)17(19)23;/h6-7,10,12,16,20-22H,5,8-9,11H2,1-4H3,(H2,19,23);1H.
What are the key properties of 5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride?
5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride has a molecular weight of 390.91 g/mol, XLogP of 2.10, 11 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(5,5-dimethoxyheptan-2-ylamino)-1-hydroxyethyl]-2-hydroxybenzamide;hydrochloride is sourced from PubChem (CID 21389510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).