C25H28N2O5 — CID 70142955
5-[2-[2,2-bis(4-methoxyphenyl)ethylamino]-1-hydroxyethyl]-2-hydroxybenzamide (PubChem CID 70142955) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 5-[2-[2,2-bis(4-methoxyphenyl)ethylamino]-1-hydroxyethyl]-2-hydroxybenzamide.
| Compound Name | 5-[2-[2,2-bis(4-methoxyphenyl)ethylamino]-1-hydroxyethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 70142955 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 5-[2-[2,2-bis(4-methoxyphenyl)ethylamino]-1-hydroxyethyl]-2-hydroxybenzamide |
| SMILES | COc1ccc(C(CNCC(O)c2ccc(O)c(C(N)=O)c2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H28N2O5/c1-31-19-8-3-16(4-9-19)22(17-5-10-20(32-2)11-6-17)14-27-15-24(29)18-7-12-23(28)21(13-18)25(26)30/h3-13,22,24,27-29H,14-15H2,1-2H3,(H2,26,30) |
| InChIKey | IBSOZFFDUWVUFW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |