C19H23FN2O3 — CID 12814711
5-[2-[4-(4-fluorophenyl)butan-2-ylamino]-1-hydroxyethyl]-2-hydroxybenzamide (PubChem CID 12814711) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is 5-[2-[4-(4-fluorophenyl)butan-2-ylamino]-1-hydroxyethyl]-2-hydroxybenzamide.
| Compound Name | 5-[2-[4-(4-fluorophenyl)butan-2-ylamino]-1-hydroxyethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 12814711 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 5-[2-[4-(4-fluorophenyl)butan-2-ylamino]-1-hydroxyethyl]-2-hydroxybenzamide |
| SMILES | CC(CCc1ccc(F)cc1)NCC(O)c1ccc(O)c(C(N)=O)c1 |
| InChI | InChI=1S/C19H23FN2O3/c1-12(2-3-13-4-7-15(20)8-5-13)22-11-18(24)14-6-9-17(23)16(10-14)19(21)25/h4-10,12,18,22-24H,2-3,11H2,1H3,(H2,21,25) |
| InChIKey | CGZWOSZLLCFYIB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |