About 2-[4-(1-ethoxyethoxy)-3-iodophenyl]propan-2-yl 2-bromoacetate
2-[4-(1-ethoxyethoxy)-3-iodophenyl]propan-2-yl 2-bromoacetate (PubChem CID 177244347) has the molecular formula C15H20BrIO4
and a molecular weight of 471.13 g/mol. Its IUPAC name is 2-[4-(1-ethoxyethoxy)-3-iodophenyl]propan-2-yl 2-bromoacetate.
Molecular Properties
| Compound Name | 2-[4-(1-ethoxyethoxy)-3-iodophenyl]propan-2-yl 2-bromoacetate |
| PubChem CID | 177244347 |
| Molecular Formula | C15H20BrIO4 |
| Molecular Weight | 471.13 g/mol |
| Exact Mass | 469.96 |
| IUPAC Name | 2-[4-(1-ethoxyethoxy)-3-iodophenyl]propan-2-yl 2-bromoacetate |
| SMILES | CCOC(C)Oc1ccc(C(C)(C)OC(=O)CBr)cc1I |
| InChI | InChI=1S/C15H20BrIO4/c1-5-19-10(2)20-13-7-6-11(8-12(13)17)15(3,4)21-14(18)9-16/h6-8,10H,5,9H2,1-4H3 |
| InChIKey | TZTTVZSZYXXGII-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.13 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1-ethoxyethoxy)-3-iodophenyl]propan-2-yl 2-bromoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1-ethoxyethoxy)-3-iodophenyl]propan-2-yl 2-bromoacetate?
The IUPAC name of 2-[4-(1-ethoxyethoxy)-3-iodophenyl]propan-2-yl 2-bromoacetate (CID 177244347) is 2-[4-(1-ethoxyethoxy)-3-iodophenyl]propan-2-yl 2-bromoacetate.
What is the SMILES notation for 2-[4-(1-ethoxyethoxy)-3-iodophenyl]propan-2-yl 2-bromoacetate?
The canonical SMILES for 2-[4-(1-ethoxyethoxy)-3-iodophenyl]propan-2-yl 2-bromoacetate is CCOC(C)Oc1ccc(C(C)(C)OC(=O)CBr)cc1I.
What is the InChIKey of 2-[4-(1-ethoxyethoxy)-3-iodophenyl]propan-2-yl 2-bromoacetate?
The InChIKey is TZTTVZSZYXXGII-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20BrIO4/c1-5-19-10(2)20-13-7-6-11(8-12(13)17)15(3,4)21-14(18)9-16/h6-8,10H,5,9H2,1-4H3.
What are the key properties of 2-[4-(1-ethoxyethoxy)-3-iodophenyl]propan-2-yl 2-bromoacetate?
2-[4-(1-ethoxyethoxy)-3-iodophenyl]propan-2-yl 2-bromoacetate has a molecular weight of 471.13 g/mol, XLogP of 4.23, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1-ethoxyethoxy)-3-iodophenyl]propan-2-yl 2-bromoacetate is sourced from PubChem (CID 177244347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).