C22H35IO5 — CID 166890347
1-[4-(1-ethoxyethoxy)-5-iodo-2-methoxyphenyl]ethyl 2-ethyl-2,3,3-trimethylbutanoate (PubChem CID 166890347) has the molecular formula C22H35IO5 and a molecular weight of 506.42 g/mol. Its IUPAC name is 1-[4-(1-ethoxyethoxy)-5-iodo-2-methoxyphenyl]ethyl 2-ethyl-2,3,3-trimethylbutanoate.
| Compound Name | 1-[4-(1-ethoxyethoxy)-5-iodo-2-methoxyphenyl]ethyl 2-ethyl-2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 166890347 |
| Molecular Formula | C22H35IO5 |
| Molecular Weight | 506.42 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 1-[4-(1-ethoxyethoxy)-5-iodo-2-methoxyphenyl]ethyl 2-ethyl-2,3,3-trimethylbutanoate |
| SMILES | CCOC(C)Oc1cc(OC)c(C(C)OC(=O)C(C)(CC)C(C)(C)C)cc1I |
| InChI | InChI=1S/C22H35IO5/c1-10-22(8,21(5,6)7)20(24)27-14(3)16-12-17(23)19(13-18(16)25-9)28-15(4)26-11-2/h12-15H,10-11H2,1-9H3 |
| InChIKey | OQDHWFTYYGWUIA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.42 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|