C12H16Br2O3 — CID 174187739
1,2-dibromo-5-ethoxy-3-(1-ethoxyethoxy)benzene (PubChem CID 174187739) has the molecular formula C12H16Br2O3 and a molecular weight of 368.07 g/mol. Its IUPAC name is 1,2-dibromo-5-ethoxy-3-(1-ethoxyethoxy)benzene.
| Compound Name | 1,2-dibromo-5-ethoxy-3-(1-ethoxyethoxy)benzene |
|---|---|
| PubChem CID | 174187739 |
| Molecular Formula | C12H16Br2O3 |
| Molecular Weight | 368.07 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 1,2-dibromo-5-ethoxy-3-(1-ethoxyethoxy)benzene |
| SMILES | CCOc1cc(Br)c(Br)c(OC(C)OCC)c1 |
| InChI | InChI=1S/C12H16Br2O3/c1-4-15-8(3)17-11-7-9(16-5-2)6-10(13)12(11)14/h6-8H,4-5H2,1-3H3 |
| InChIKey | PNPUQPKBGNLBQH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.07 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|