C53H74O5 — CID 145349287
[4-[11-[4-(1-ethoxyethoxy)phenyl]-3-(4-hydroxyphenyl)-2,2,5,5,6,9,9,10,13,13-decamethyltetradecan-7-yl]phenyl] benzoate (PubChem CID 145349287) has the molecular formula C53H74O5 and a molecular weight of 791.17 g/mol. Its IUPAC name is [4-[11-[4-(1-ethoxyethoxy)phenyl]-3-(4-hydroxyphenyl)-2,2,5,5,6,9,9,10,13,13-decamethyltetradecan-7-yl]phenyl] benzoate.
| Compound Name | [4-[11-[4-(1-ethoxyethoxy)phenyl]-3-(4-hydroxyphenyl)-2,2,5,5,6,9,9,10,13,13-decamethyltetradecan-7-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 145349287 |
| Molecular Formula | C53H74O5 |
| Molecular Weight | 791.17 g/mol |
| Exact Mass | 790.55 |
| IUPAC Name | [4-[11-[4-(1-ethoxyethoxy)phenyl]-3-(4-hydroxyphenyl)-2,2,5,5,6,9,9,10,13,13-decamethyltetradecan-7-yl]phenyl] benzoate |
| SMILES | CCOC(C)Oc1ccc(C(CC(C)(C)C)C(C)C(C)(C)CC(c2ccc(OC(=O)c3ccccc3)cc2)C(C)C(C)(C)CC(c2ccc(O)cc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C53H74O5/c1-15-56-38(4)57-44-29-23-39(24-30-44)46(33-50(5,6)7)36(2)52(11,12)34-47(40-25-31-45(32-26-40)58-49(55)42-19-17-16-18-20-42)37(3)53(13,14)35-48(51(8,9)10)41-21-27-43(54)28-22-41/h16-32,36-38,46-48,54H,15,33-35H2,1-14H3 |
| InChIKey | VXFALIKGEFXTRW-UHFFFAOYSA-N |
| XLogP | 14.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.17 |
| LogP ≤ 5 | 14.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|