C24H34O — CID 91223677
1-(1-phenylethoxy)-4-(2,2,5,5-tetramethylhexan-3-yl)benzene (PubChem CID 91223677) has the molecular formula C24H34O and a molecular weight of 338.54 g/mol. Its IUPAC name is 1-(1-phenylethoxy)-4-(2,2,5,5-tetramethylhexan-3-yl)benzene.
| Compound Name | 1-(1-phenylethoxy)-4-(2,2,5,5-tetramethylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 91223677 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 1-(1-phenylethoxy)-4-(2,2,5,5-tetramethylhexan-3-yl)benzene |
| SMILES | CC(Oc1ccc(C(CC(C)(C)C)C(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H34O/c1-18(19-11-9-8-10-12-19)25-21-15-13-20(14-16-21)22(24(5,6)7)17-23(2,3)4/h8-16,18,22H,17H2,1-7H3 |
| InChIKey | LXJZMFVJSQIWPI-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |