C26H44O2 — CID 123324499
1-(1-cyclohexyloxy-2-methylpropoxy)-4-(2,2,5,5-tetramethylhexan-3-yl)benzene (PubChem CID 123324499) has the molecular formula C26H44O2 and a molecular weight of 388.64 g/mol. Its IUPAC name is 1-(1-cyclohexyloxy-2-methylpropoxy)-4-(2,2,5,5-tetramethylhexan-3-yl)benzene.
| Compound Name | 1-(1-cyclohexyloxy-2-methylpropoxy)-4-(2,2,5,5-tetramethylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 123324499 |
| Molecular Formula | C26H44O2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | 1-(1-cyclohexyloxy-2-methylpropoxy)-4-(2,2,5,5-tetramethylhexan-3-yl)benzene |
| SMILES | CC(C)C(Oc1ccc(C(CC(C)(C)C)C(C)(C)C)cc1)OC1CCCCC1 |
| InChI | InChI=1S/C26H44O2/c1-19(2)24(27-21-12-10-9-11-13-21)28-22-16-14-20(15-17-22)23(26(6,7)8)18-25(3,4)5/h14-17,19,21,23-24H,9-13,18H2,1-8H3 |
| InChIKey | HVLDKSSNYZTSPQ-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|