C31H52O2 — CID 123863336
1-[cyclohexyloxy-(1-ethylcyclohexyl)methoxy]-4-(2,2,5,5-tetramethylhexan-3-yl)benzene (PubChem CID 123863336) has the molecular formula C31H52O2 and a molecular weight of 456.76 g/mol. Its IUPAC name is 1-[cyclohexyloxy-(1-ethylcyclohexyl)methoxy]-4-(2,2,5,5-tetramethylhexan-3-yl)benzene.
| Compound Name | 1-[cyclohexyloxy-(1-ethylcyclohexyl)methoxy]-4-(2,2,5,5-tetramethylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 123863336 |
| Molecular Formula | C31H52O2 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.40 |
| IUPAC Name | 1-[cyclohexyloxy-(1-ethylcyclohexyl)methoxy]-4-(2,2,5,5-tetramethylhexan-3-yl)benzene |
| SMILES | CCC1(C(Oc2ccc(C(CC(C)(C)C)C(C)(C)C)cc2)OC2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C31H52O2/c1-8-31(21-13-10-14-22-31)28(32-25-15-11-9-12-16-25)33-26-19-17-24(18-20-26)27(30(5,6)7)23-29(2,3)4/h17-20,25,27-28H,8-16,21-23H2,1-7H3 |
| InChIKey | WPEMYLVEOQGJEC-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|