C30H50O3 — CID 123370293
2-(2-cyclohexyl-1-cyclohexyloxyethoxy)-5-(2,2,5,5-tetramethylhexan-3-yl)phenol (PubChem CID 123370293) has the molecular formula C30H50O3 and a molecular weight of 458.73 g/mol. Its IUPAC name is 2-(2-cyclohexyl-1-cyclohexyloxyethoxy)-5-(2,2,5,5-tetramethylhexan-3-yl)phenol.
| Compound Name | 2-(2-cyclohexyl-1-cyclohexyloxyethoxy)-5-(2,2,5,5-tetramethylhexan-3-yl)phenol |
|---|---|
| PubChem CID | 123370293 |
| Molecular Formula | C30H50O3 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 458.38 |
| IUPAC Name | 2-(2-cyclohexyl-1-cyclohexyloxyethoxy)-5-(2,2,5,5-tetramethylhexan-3-yl)phenol |
| SMILES | CC(C)(C)CC(c1ccc(OC(CC2CCCCC2)OC2CCCCC2)c(O)c1)C(C)(C)C |
| InChI | InChI=1S/C30H50O3/c1-29(2,3)21-25(30(4,5)6)23-17-18-27(26(31)20-23)33-28(19-22-13-9-7-10-14-22)32-24-15-11-8-12-16-24/h17-18,20,22,24-25,28,31H,7-16,19,21H2,1-6H3 |
| InChIKey | HZUWYWNYJBTTNM-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|