C18H30O3 — CID 71103144
2,6-dimethoxy-4-(2,2,5,5-tetramethylhexan-3-yl)phenol (PubChem CID 71103144) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2,6-dimethoxy-4-(2,2,5,5-tetramethylhexan-3-yl)phenol.
| Compound Name | 2,6-dimethoxy-4-(2,2,5,5-tetramethylhexan-3-yl)phenol |
|---|---|
| PubChem CID | 71103144 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 2,6-dimethoxy-4-(2,2,5,5-tetramethylhexan-3-yl)phenol |
| SMILES | COc1cc(C(CC(C)(C)C)C(C)(C)C)cc(OC)c1O |
| InChI | InChI=1S/C18H30O3/c1-17(2,3)11-13(18(4,5)6)12-9-14(20-7)16(19)15(10-12)21-8/h9-10,13,19H,11H2,1-8H3 |
| InChIKey | DBUJPQJIPJCXGR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |