C11H18N2O3 — CID 171219296
4-[(1S)-1,3-diaminopropyl]-2,6-dimethoxyphenol (PubChem CID 171219296) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-[(1S)-1,3-diaminopropyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(1S)-1,3-diaminopropyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 171219296 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 4-[(1S)-1,3-diaminopropyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc([C@@H](N)CCN)cc(OC)c1O |
| InChI | InChI=1S/C11H18N2O3/c1-15-9-5-7(8(13)3-4-12)6-10(16-2)11(9)14/h5-6,8,14H,3-4,12-13H2,1-2H3/t8-/m0/s1 |
| InChIKey | JIYSBBPZFBAZFY-QMMMGPOBSA-N |
| XLogP | 0.76 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |