C12H20N2O3 — CID 171199771
4-[(1R)-1,4-diaminobutyl]-2,6-dimethoxyphenol (PubChem CID 171199771) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 4-[(1R)-1,4-diaminobutyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(1R)-1,4-diaminobutyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 171199771 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 4-[(1R)-1,4-diaminobutyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc([C@H](N)CCCN)cc(OC)c1O |
| InChI | InChI=1S/C12H20N2O3/c1-16-10-6-8(9(14)4-3-5-13)7-11(17-2)12(10)15/h6-7,9,15H,3-5,13-14H2,1-2H3/t9-/m1/s1 |
| InChIKey | QKPTUJPPBGCXSV-SECBINFHSA-N |
| XLogP | 1.15 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |