C11H18Cl2N2O — CID 171211107
(1R)-1-(4-chloro-3-methoxyphenyl)butane-1,4-diamine;hydrochloride (PubChem CID 171211107) has the molecular formula C11H18Cl2N2O and a molecular weight of 265.18 g/mol. Its IUPAC name is (1R)-1-(4-chloro-3-methoxyphenyl)butane-1,4-diamine;hydrochloride.
| Compound Name | (1R)-1-(4-chloro-3-methoxyphenyl)butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171211107 |
| Molecular Formula | C11H18Cl2N2O |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (1R)-1-(4-chloro-3-methoxyphenyl)butane-1,4-diamine;hydrochloride |
| SMILES | COc1cc([C@H](N)CCCN)ccc1Cl.Cl |
| InChI | InChI=1S/C11H17ClN2O.ClH/c1-15-11-7-8(4-5-9(11)12)10(14)3-2-6-13;/h4-5,7,10H,2-3,6,13-14H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | KRWDCLZWCRYHFM-HNCPQSOCSA-N |
| XLogP | 2.51 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |