C11H17Cl2NO2 — CID 171230755
(4S)-4-amino-4-(4-chloro-3-methoxyphenyl)butan-1-ol;hydrochloride (PubChem CID 171230755) has the molecular formula C11H17Cl2NO2 and a molecular weight of 266.17 g/mol. Its IUPAC name is (4S)-4-amino-4-(4-chloro-3-methoxyphenyl)butan-1-ol;hydrochloride.
| Compound Name | (4S)-4-amino-4-(4-chloro-3-methoxyphenyl)butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171230755 |
| Molecular Formula | C11H17Cl2NO2 |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | (4S)-4-amino-4-(4-chloro-3-methoxyphenyl)butan-1-ol;hydrochloride |
| SMILES | COc1cc([C@@H](N)CCCO)ccc1Cl.Cl |
| InChI | InChI=1S/C11H16ClNO2.ClH/c1-15-11-7-8(4-5-9(11)12)10(13)3-2-6-14;/h4-5,7,10,14H,2-3,6,13H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | ZEBNYCDHJOZSDC-PPHPATTJSA-N |
| XLogP | 2.54 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |