C14H23NO3 — CID 171219313
4-[(1S)-1-aminohexyl]-2,6-dimethoxyphenol (PubChem CID 171219313) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 4-[(1S)-1-aminohexyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(1S)-1-aminohexyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 171219313 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 4-[(1S)-1-aminohexyl]-2,6-dimethoxyphenol |
| SMILES | CCCCC[C@H](N)c1cc(OC)c(O)c(OC)c1 |
| InChI | InChI=1S/C14H23NO3/c1-4-5-6-7-11(15)10-8-12(17-2)14(16)13(9-10)18-3/h8-9,11,16H,4-7,15H2,1-3H3/t11-/m0/s1 |
| InChIKey | NLIBZNXHFKNVBW-NSHDSACASA-N |
| XLogP | 2.99 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|