C16H26BrNO2 — CID 69291505
1-(4-bromo-3,5-dimethoxyphenyl)octan-1-amine (PubChem CID 69291505) has the molecular formula C16H26BrNO2 and a molecular weight of 344.29 g/mol. Its IUPAC name is 1-(4-bromo-3,5-dimethoxyphenyl)octan-1-amine.
| Compound Name | 1-(4-bromo-3,5-dimethoxyphenyl)octan-1-amine |
|---|---|
| PubChem CID | 69291505 |
| Molecular Formula | C16H26BrNO2 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-(4-bromo-3,5-dimethoxyphenyl)octan-1-amine |
| SMILES | CCCCCCCC(N)c1cc(OC)c(Br)c(OC)c1 |
| InChI | InChI=1S/C16H26BrNO2/c1-4-5-6-7-8-9-13(18)12-10-14(19-2)16(17)15(11-12)20-3/h10-11,13H,4-9,18H2,1-3H3 |
| InChIKey | SFDSURDJYHMTCS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|