C42H68O3 — CID 123612032
4-[9-[4-(1-cyclohexyloxy-2,2-dimethylpropoxy)phenyl]-2,2,5,5,7,7,10,10-octamethylundecan-4-yl]phenol (PubChem CID 123612032) has the molecular formula C42H68O3 and a molecular weight of 621.00 g/mol. Its IUPAC name is 4-[9-[4-(1-cyclohexyloxy-2,2-dimethylpropoxy)phenyl]-2,2,5,5,7,7,10,10-octamethylundecan-4-yl]phenol.
| Compound Name | 4-[9-[4-(1-cyclohexyloxy-2,2-dimethylpropoxy)phenyl]-2,2,5,5,7,7,10,10-octamethylundecan-4-yl]phenol |
|---|---|
| PubChem CID | 123612032 |
| Molecular Formula | C42H68O3 |
| Molecular Weight | 621.00 g/mol |
| Exact Mass | 620.52 |
| IUPAC Name | 4-[9-[4-(1-cyclohexyloxy-2,2-dimethylpropoxy)phenyl]-2,2,5,5,7,7,10,10-octamethylundecan-4-yl]phenol |
| SMILES | CC(C)(C)CC(c1ccc(O)cc1)C(C)(C)CC(C)(C)CC(c1ccc(OC(OC2CCCCC2)C(C)(C)C)cc1)C(C)(C)C |
| InChI | InChI=1S/C42H68O3/c1-38(2,3)27-36(31-19-23-32(43)24-20-31)42(12,13)29-41(10,11)28-35(39(4,5)6)30-21-25-34(26-22-30)45-37(40(7,8)9)44-33-17-15-14-16-18-33/h19-26,33,35-37,43H,14-18,27-29H2,1-13H3 |
| InChIKey | ZAVDXGFYMHAYAN-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.00 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|