C47H72O4 — CID 123876903
4-[7-ethyl-9-[4-[1-[2-(4-hexan-3-ylphenoxy)ethoxy]ethoxy]phenyl]-2,2,5,5,7,10-hexamethylundecan-4-yl]phenol (PubChem CID 123876903) has the molecular formula C47H72O4 and a molecular weight of 701.09 g/mol. Its IUPAC name is 4-[7-ethyl-9-[4-[1-[2-(4-hexan-3-ylphenoxy)ethoxy]ethoxy]phenyl]-2,2,5,5,7,10-hexamethylundecan-4-yl]phenol.
| Compound Name | 4-[7-ethyl-9-[4-[1-[2-(4-hexan-3-ylphenoxy)ethoxy]ethoxy]phenyl]-2,2,5,5,7,10-hexamethylundecan-4-yl]phenol |
|---|---|
| PubChem CID | 123876903 |
| Molecular Formula | C47H72O4 |
| Molecular Weight | 701.09 g/mol |
| Exact Mass | 700.54 |
| IUPAC Name | 4-[7-ethyl-9-[4-[1-[2-(4-hexan-3-ylphenoxy)ethoxy]ethoxy]phenyl]-2,2,5,5,7,10-hexamethylundecan-4-yl]phenol |
| SMILES | CCCC(CC)c1ccc(OCCOC(C)Oc2ccc(C(CC(C)(CC)CC(C)(C)C(CC(C)(C)C)c3ccc(O)cc3)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C47H72O4/c1-13-16-36(14-2)37-19-25-41(26-20-37)50-30-29-49-35(6)51-42-27-21-38(22-28-42)43(34(4)5)31-47(12,15-3)33-46(10,11)44(32-45(7,8)9)39-17-23-40(48)24-18-39/h17-28,34-36,43-44,48H,13-16,29-33H2,1-12H3 |
| InChIKey | GEPHLBVBRCSKTI-UHFFFAOYSA-N |
| XLogP | 13.69 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.09 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|