C30H45NO3 — CID 123490270
4-[4-[1-[2-(4-cyclohexylphenoxy)ethoxy]ethoxy]phenyl]-2,5-dimethylhexan-2-amine (PubChem CID 123490270) has the molecular formula C30H45NO3 and a molecular weight of 467.69 g/mol. Its IUPAC name is 4-[4-[1-[2-(4-cyclohexylphenoxy)ethoxy]ethoxy]phenyl]-2,5-dimethylhexan-2-amine.
| Compound Name | 4-[4-[1-[2-(4-cyclohexylphenoxy)ethoxy]ethoxy]phenyl]-2,5-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 123490270 |
| Molecular Formula | C30H45NO3 |
| Molecular Weight | 467.69 g/mol |
| Exact Mass | 467.34 |
| IUPAC Name | 4-[4-[1-[2-(4-cyclohexylphenoxy)ethoxy]ethoxy]phenyl]-2,5-dimethylhexan-2-amine |
| SMILES | CC(OCCOc1ccc(C2CCCCC2)cc1)Oc1ccc(C(CC(C)(C)N)C(C)C)cc1 |
| InChI | InChI=1S/C30H45NO3/c1-22(2)29(21-30(4,5)31)26-13-17-28(18-14-26)34-23(3)32-19-20-33-27-15-11-25(12-16-27)24-9-7-6-8-10-24/h11-18,22-24,29H,6-10,19-21,31H2,1-5H3 |
| InChIKey | QOMRHSGDXKIPOT-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.69 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|