C29H41IO2 — CID 129173092
1-cyclohexyl-4-[1-[4-(2-iodo-2,5-dimethylhexan-3-yl)phenoxy]ethoxymethyl]benzene (PubChem CID 129173092) has the molecular formula C29H41IO2 and a molecular weight of 548.55 g/mol. Its IUPAC name is 1-cyclohexyl-4-[1-[4-(2-iodo-2,5-dimethylhexan-3-yl)phenoxy]ethoxymethyl]benzene.
| Compound Name | 1-cyclohexyl-4-[1-[4-(2-iodo-2,5-dimethylhexan-3-yl)phenoxy]ethoxymethyl]benzene |
|---|---|
| PubChem CID | 129173092 |
| Molecular Formula | C29H41IO2 |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 1-cyclohexyl-4-[1-[4-(2-iodo-2,5-dimethylhexan-3-yl)phenoxy]ethoxymethyl]benzene |
| SMILES | CC(C)CC(c1ccc(OC(C)OCc2ccc(C3CCCCC3)cc2)cc1)C(C)(C)I |
| InChI | InChI=1S/C29H41IO2/c1-21(2)19-28(29(4,5)30)26-15-17-27(18-16-26)32-22(3)31-20-23-11-13-25(14-12-23)24-9-7-6-8-10-24/h11-18,21-22,24,28H,6-10,19-20H2,1-5H3 |
| InChIKey | DIIHOCINBWBGKP-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|