C20H32O3 — CID 143952563
3-[1-[4-(2,2,5-trimethylhexan-3-yl)phenoxy]ethoxy]propanal (PubChem CID 143952563) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 3-[1-[4-(2,2,5-trimethylhexan-3-yl)phenoxy]ethoxy]propanal.
| Compound Name | 3-[1-[4-(2,2,5-trimethylhexan-3-yl)phenoxy]ethoxy]propanal |
|---|---|
| PubChem CID | 143952563 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 3-[1-[4-(2,2,5-trimethylhexan-3-yl)phenoxy]ethoxy]propanal |
| SMILES | CC(C)CC(c1ccc(OC(C)OCCC=O)cc1)C(C)(C)C |
| InChI | InChI=1S/C20H32O3/c1-15(2)14-19(20(4,5)6)17-8-10-18(11-9-17)23-16(3)22-13-7-12-21/h8-12,15-16,19H,7,13-14H2,1-6H3 |
| InChIKey | OEFSFNNCWSYFKS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|