C22H30O3S — CID 143952498
1-[1-[2-(benzenesulfinyl)ethoxy]ethoxy]-4-(3,3-dimethylbutan-2-yl)benzene (PubChem CID 143952498) has the molecular formula C22H30O3S and a molecular weight of 374.55 g/mol. Its IUPAC name is 1-[1-[2-(benzenesulfinyl)ethoxy]ethoxy]-4-(3,3-dimethylbutan-2-yl)benzene.
| Compound Name | 1-[1-[2-(benzenesulfinyl)ethoxy]ethoxy]-4-(3,3-dimethylbutan-2-yl)benzene |
|---|---|
| PubChem CID | 143952498 |
| Molecular Formula | C22H30O3S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 1-[1-[2-(benzenesulfinyl)ethoxy]ethoxy]-4-(3,3-dimethylbutan-2-yl)benzene |
| SMILES | CC(OCCS(=O)c1ccccc1)Oc1ccc(C(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H30O3S/c1-17(22(3,4)5)19-11-13-20(14-12-19)25-18(2)24-15-16-26(23)21-9-7-6-8-10-21/h6-14,17-18H,15-16H2,1-5H3 |
| InChIKey | UKRUPPDKVBQQOV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|