C20H25IO4S — CID 163432142
1-[1-[3-(benzenesulfonyl)propoxy]ethoxy]-4-(1-iodopropan-2-yl)benzene (PubChem CID 163432142) has the molecular formula C20H25IO4S and a molecular weight of 488.39 g/mol. Its IUPAC name is 1-[1-[3-(benzenesulfonyl)propoxy]ethoxy]-4-(1-iodopropan-2-yl)benzene.
| Compound Name | 1-[1-[3-(benzenesulfonyl)propoxy]ethoxy]-4-(1-iodopropan-2-yl)benzene |
|---|---|
| PubChem CID | 163432142 |
| Molecular Formula | C20H25IO4S |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | 1-[1-[3-(benzenesulfonyl)propoxy]ethoxy]-4-(1-iodopropan-2-yl)benzene |
| SMILES | CC(OCCCS(=O)(=O)c1ccccc1)Oc1ccc(C(C)CI)cc1 |
| InChI | InChI=1S/C20H25IO4S/c1-16(15-21)18-9-11-19(12-10-18)25-17(2)24-13-6-14-26(22,23)20-7-4-3-5-8-20/h3-5,7-12,16-17H,6,13-15H2,1-2H3 |
| InChIKey | ARKNZGHTZXTHPU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|