C22H36O2 — CID 123347568
1-[1-(2-cyclohexylethoxy)ethoxy]-4-(3,3-dimethylbutan-2-yl)benzene (PubChem CID 123347568) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is 1-[1-(2-cyclohexylethoxy)ethoxy]-4-(3,3-dimethylbutan-2-yl)benzene.
| Compound Name | 1-[1-(2-cyclohexylethoxy)ethoxy]-4-(3,3-dimethylbutan-2-yl)benzene |
|---|---|
| PubChem CID | 123347568 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | 1-[1-(2-cyclohexylethoxy)ethoxy]-4-(3,3-dimethylbutan-2-yl)benzene |
| SMILES | CC(OCCC1CCCCC1)Oc1ccc(C(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H36O2/c1-17(22(3,4)5)20-11-13-21(14-12-20)24-18(2)23-16-15-19-9-7-6-8-10-19/h11-14,17-19H,6-10,15-16H2,1-5H3 |
| InChIKey | UPRXNDYJWITAMA-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|