C21H34O2 — CID 140648633
1-[1-(2-cyclohexylethoxy)-2,2-dimethylpropoxy]-4-ethylbenzene (PubChem CID 140648633) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is 1-[1-(2-cyclohexylethoxy)-2,2-dimethylpropoxy]-4-ethylbenzene.
| Compound Name | 1-[1-(2-cyclohexylethoxy)-2,2-dimethylpropoxy]-4-ethylbenzene |
|---|---|
| PubChem CID | 140648633 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | 1-[1-(2-cyclohexylethoxy)-2,2-dimethylpropoxy]-4-ethylbenzene |
| SMILES | CCc1ccc(OC(OCCC2CCCCC2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H34O2/c1-5-17-11-13-19(14-12-17)23-20(21(2,3)4)22-16-15-18-9-7-6-8-10-18/h11-14,18,20H,5-10,15-16H2,1-4H3 |
| InChIKey | XLXGBJZGJFCENF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|