C35H56O2 — CID 123755292
1-[2-cyclohexylethoxy-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]methyl]adamantane (PubChem CID 123755292) has the molecular formula C35H56O2 and a molecular weight of 508.83 g/mol. Its IUPAC name is 1-[2-cyclohexylethoxy-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]methyl]adamantane.
| Compound Name | 1-[2-cyclohexylethoxy-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]methyl]adamantane |
|---|---|
| PubChem CID | 123755292 |
| Molecular Formula | C35H56O2 |
| Molecular Weight | 508.83 g/mol |
| Exact Mass | 508.43 |
| IUPAC Name | 1-[2-cyclohexylethoxy-[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]methyl]adamantane |
| SMILES | CC(C)(C)CC(c1ccc(OC(OCCC2CCCCC2)C23CC4CC(CC(C4)C2)C3)cc1)C(C)(C)C |
| InChI | InChI=1S/C35H56O2/c1-33(2,3)24-31(34(4,5)6)29-12-14-30(15-13-29)37-32(36-17-16-25-10-8-7-9-11-25)35-21-26-18-27(22-35)20-28(19-26)23-35/h12-15,25-28,31-32H,7-11,16-24H2,1-6H3 |
| InChIKey | BBPOEFQLHPGFNB-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.83 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|