C28H44O2 — CID 123635954
[4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]-(1-tricyclo[4.3.1.13,8]undecanyl)methanol (PubChem CID 123635954) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is [4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]-(1-tricyclo[4.3.1.13,8]undecanyl)methanol.
| Compound Name | [4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]-(1-tricyclo[4.3.1.13,8]undecanyl)methanol |
|---|---|
| PubChem CID | 123635954 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | [4-(2,2,5,5-tetramethylhexan-3-yl)phenoxy]-(1-tricyclo[4.3.1.13,8]undecanyl)methanol |
| SMILES | CC(C)(C)CC(c1ccc(OC(O)C23CC4CCC(CC(C4)C2)C3)cc1)C(C)(C)C |
| InChI | InChI=1S/C28H44O2/c1-26(2,3)18-24(27(4,5)6)22-9-11-23(12-10-22)30-25(29)28-15-19-7-8-20(16-28)14-21(13-19)17-28/h9-12,19-21,24-25,29H,7-8,13-18H2,1-6H3 |
| InChIKey | MHRPYIIIPNNTDT-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|