C18H24O2 — CID 7064962
(R)-1-adamantyl-(4-methoxyphenyl)methanol (PubChem CID 7064962) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is (R)-1-adamantyl-(4-methoxyphenyl)methanol.
| Compound Name | (R)-1-adamantyl-(4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 7064962 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (R)-1-adamantyl-(4-methoxyphenyl)methanol |
| SMILES | COc1ccc([C@H](O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C18H24O2/c1-20-16-4-2-15(3-5-16)17(19)18-9-12-6-13(10-18)8-14(7-12)11-18/h2-5,12-14,17,19H,6-11H2,1H3/t12?,13?,14?,17-,18?/m0/s1 |
| InChIKey | KNQJEEXXKZYBOT-BMRMXDDPSA-N |
| XLogP | 3.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |