About 1-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethyl]adamantane
1-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethyl]adamantane (PubChem CID 123311126) has the molecular formula C29H46O2
and a molecular weight of 426.69 g/mol. Its IUPAC name is 1-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethyl]adamantane.
Molecular Properties
| Compound Name | 1-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethyl]adamantane |
| PubChem CID | 123311126 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | 1-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethyl]adamantane |
| SMILES | CCC(C)C(CC(C)(C)C)c1ccc(OC(C)OCC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C29H46O2/c1-7-20(2)27(18-28(4,5)6)25-8-10-26(11-9-25)31-21(3)30-19-29-15-22-12-23(16-29)14-24(13-22)17-29/h8-11,20-24,27H,7,12-19H2,1-6H3 |
| InChIKey | HMSWLAXWDYRHIY-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethyl]adamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethyl]adamantane?
The IUPAC name of 1-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethyl]adamantane (CID 123311126) is 1-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethyl]adamantane.
What is the SMILES notation for 1-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethyl]adamantane?
The canonical SMILES for 1-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethyl]adamantane is CCC(C)C(CC(C)(C)C)c1ccc(OC(C)OCC23CC4CC(CC(C4)C2)C3)cc1.
What is the InChIKey of 1-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethyl]adamantane?
The InChIKey is HMSWLAXWDYRHIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H46O2/c1-7-20(2)27(18-28(4,5)6)25-8-10-26(11-9-25)31-21(3)30-19-29-15-22-12-23(16-29)14-24(13-22)17-29/h8-11,20-24,27H,7,12-19H2,1-6H3.
What are the key properties of 1-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethyl]adamantane?
1-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethyl]adamantane has a molecular weight of 426.69 g/mol, XLogP of 8.21, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethyl]adamantane is sourced from PubChem (CID 123311126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).