C26H38O3S — CID 123660438
1-methoxy-4-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethylsulfanyl]benzene (PubChem CID 123660438) has the molecular formula C26H38O3S and a molecular weight of 430.65 g/mol. Its IUPAC name is 1-methoxy-4-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethylsulfanyl]benzene.
| Compound Name | 1-methoxy-4-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethylsulfanyl]benzene |
|---|---|
| PubChem CID | 123660438 |
| Molecular Formula | C26H38O3S |
| Molecular Weight | 430.65 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 1-methoxy-4-[1-[4-(2,2,5-trimethylheptan-4-yl)phenoxy]ethoxymethylsulfanyl]benzene |
| SMILES | CCC(C)C(CC(C)(C)C)c1ccc(OC(C)OCSc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H38O3S/c1-8-19(2)25(17-26(4,5)6)21-9-11-23(12-10-21)29-20(3)28-18-30-24-15-13-22(27-7)14-16-24/h9-16,19-20,25H,8,17-18H2,1-7H3 |
| InChIKey | JUHYIEFABYUPTA-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.65 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|