C15H25NO — CID 58442303
1-(4-methoxyphenyl)-N,N,3,3-tetramethylbutan-1-amine (PubChem CID 58442303) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N,N,3,3-tetramethylbutan-1-amine.
| Compound Name | 1-(4-methoxyphenyl)-N,N,3,3-tetramethylbutan-1-amine |
|---|---|
| PubChem CID | 58442303 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 1-(4-methoxyphenyl)-N,N,3,3-tetramethylbutan-1-amine |
| SMILES | COc1ccc(C(CC(C)(C)C)N(C)C)cc1 |
| InChI | InChI=1S/C15H25NO/c1-15(2,3)11-14(16(4)5)12-7-9-13(17-6)10-8-12/h7-10,14H,11H2,1-6H3 |
| InChIKey | PYRHAAHDLYXMME-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |