C23H34N2O2 — CID 7108155
N,N'-bis[(1S)-1-(4-methoxyphenyl)propyl]-N,N'-dimethylmethanediamine (PubChem CID 7108155) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is N,N'-bis[(1S)-1-(4-methoxyphenyl)propyl]-N,N'-dimethylmethanediamine.
| Compound Name | N,N'-bis[(1S)-1-(4-methoxyphenyl)propyl]-N,N'-dimethylmethanediamine |
|---|---|
| PubChem CID | 7108155 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | N,N'-bis[(1S)-1-(4-methoxyphenyl)propyl]-N,N'-dimethylmethanediamine |
| SMILES | CC[C@@H](c1ccc(OC)cc1)N(C)CN(C)[C@@H](CC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H34N2O2/c1-7-22(18-9-13-20(26-5)14-10-18)24(3)17-25(4)23(8-2)19-11-15-21(27-6)16-12-19/h9-16,22-23H,7-8,17H2,1-6H3/t22-,23-/m0/s1 |
| InChIKey | YXAIRMNQLUEZSJ-GOTSBHOMSA-N |
| XLogP | 5.13 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|