C18H20Cl2O2 — CID 125465408
1-[(1S,4R)-1,4-dichloro-4-(4-methoxyphenyl)butyl]-4-methoxybenzene (PubChem CID 125465408) has the molecular formula C18H20Cl2O2 and a molecular weight of 339.26 g/mol. Its IUPAC name is 1-[(1S,4R)-1,4-dichloro-4-(4-methoxyphenyl)butyl]-4-methoxybenzene.
| Compound Name | 1-[(1S,4R)-1,4-dichloro-4-(4-methoxyphenyl)butyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 125465408 |
| Molecular Formula | C18H20Cl2O2 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 1-[(1S,4R)-1,4-dichloro-4-(4-methoxyphenyl)butyl]-4-methoxybenzene |
| SMILES | COc1ccc([C@H](Cl)CC[C@H](Cl)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H20Cl2O2/c1-21-15-7-3-13(4-8-15)17(19)11-12-18(20)14-5-9-16(22-2)10-6-14/h3-10,17-18H,11-12H2,1-2H3/t17-,18+ |
| InChIKey | WRPNIIFTLNJZAV-HDICACEKSA-N |
| XLogP | 5.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|