C15H25N — CID 138627440
N,N,3,3-tetramethyl-1-(3-methylphenyl)butan-1-amine (PubChem CID 138627440) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N,N,3,3-tetramethyl-1-(3-methylphenyl)butan-1-amine.
| Compound Name | N,N,3,3-tetramethyl-1-(3-methylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 138627440 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N,N,3,3-tetramethyl-1-(3-methylphenyl)butan-1-amine |
| SMILES | Cc1cccc(C(CC(C)(C)C)N(C)C)c1 |
| InChI | InChI=1S/C15H25N/c1-12-8-7-9-13(10-12)14(16(5)6)11-15(2,3)4/h7-10,14H,11H2,1-6H3 |
| InChIKey | FDOLUVRDASYWKY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |