C16H27N — CID 63889825
3,3-dimethyl-1-(3-methylphenyl)-N-propylbutan-1-amine (PubChem CID 63889825) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 3,3-dimethyl-1-(3-methylphenyl)-N-propylbutan-1-amine.
| Compound Name | 3,3-dimethyl-1-(3-methylphenyl)-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 63889825 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 3,3-dimethyl-1-(3-methylphenyl)-N-propylbutan-1-amine |
| SMILES | CCCNC(CC(C)(C)C)c1cccc(C)c1 |
| InChI | InChI=1S/C16H27N/c1-6-10-17-15(12-16(3,4)5)14-9-7-8-13(2)11-14/h7-9,11,15,17H,6,10,12H2,1-5H3 |
| InChIKey | SEAGBVHJASPKMC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |