C17H28N2O2 — CID 106674181
1-[3-(3-methylphenyl)-3-(propylamino)propyl]pyrrolidine-3,4-diol (PubChem CID 106674181) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1-[3-(3-methylphenyl)-3-(propylamino)propyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[3-(3-methylphenyl)-3-(propylamino)propyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106674181 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-[3-(3-methylphenyl)-3-(propylamino)propyl]pyrrolidine-3,4-diol |
| SMILES | CCCNC(CCN1CC(O)C(O)C1)c1cccc(C)c1 |
| InChI | InChI=1S/C17H28N2O2/c1-3-8-18-15(14-6-4-5-13(2)10-14)7-9-19-11-16(20)17(21)12-19/h4-6,10,15-18,20-21H,3,7-9,11-12H2,1-2H3 |
| InChIKey | GKYUBDBFCFYHBX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |