C13H21NS — CID 62693018
N-[1-(3-methylphenyl)-2-methylsulfanylethyl]propan-1-amine (PubChem CID 62693018) has the molecular formula C13H21NS and a molecular weight of 223.39 g/mol. Its IUPAC name is N-[1-(3-methylphenyl)-2-methylsulfanylethyl]propan-1-amine.
| Compound Name | N-[1-(3-methylphenyl)-2-methylsulfanylethyl]propan-1-amine |
|---|---|
| PubChem CID | 62693018 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.39 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-[1-(3-methylphenyl)-2-methylsulfanylethyl]propan-1-amine |
| SMILES | CCCNC(CSC)c1cccc(C)c1 |
| InChI | InChI=1S/C13H21NS/c1-4-8-14-13(10-15-3)12-7-5-6-11(2)9-12/h5-7,9,13-14H,4,8,10H2,1-3H3 |
| InChIKey | HJDWTYAYWFTRBX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |