C26H32O3P+ — CID 23419504
2,2-dimethylpropyl-tris(4-methoxyphenyl)phosphanium (PubChem CID 23419504) has the molecular formula C26H32O3P+ and a molecular weight of 423.51 g/mol. Its IUPAC name is 2,2-dimethylpropyl-tris(4-methoxyphenyl)phosphanium.
| Compound Name | 2,2-dimethylpropyl-tris(4-methoxyphenyl)phosphanium |
|---|---|
| PubChem CID | 23419504 |
| Molecular Formula | C26H32O3P+ |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 2,2-dimethylpropyl-tris(4-methoxyphenyl)phosphanium |
| SMILES | COc1ccc([P+](CC(C)(C)C)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H32O3P/c1-26(2,3)19-30(23-13-7-20(27-4)8-14-23,24-15-9-21(28-5)10-16-24)25-17-11-22(29-6)12-18-25/h7-18H,19H2,1-6H3/q+1 |
| InChIKey | MXYDHFKWEFSUIA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|