C21H38N2O — CID 159053593
N'-decyl-1-(4-methoxyphenyl)-N,N-dimethylethane-1,2-diamine (PubChem CID 159053593) has the molecular formula C21H38N2O and a molecular weight of 334.55 g/mol. Its IUPAC name is N'-decyl-1-(4-methoxyphenyl)-N,N-dimethylethane-1,2-diamine.
| Compound Name | N'-decyl-1-(4-methoxyphenyl)-N,N-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 159053593 |
| Molecular Formula | C21H38N2O |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.30 |
| IUPAC Name | N'-decyl-1-(4-methoxyphenyl)-N,N-dimethylethane-1,2-diamine |
| SMILES | CCCCCCCCCCNCC(c1ccc(OC)cc1)N(C)C |
| InChI | InChI=1S/C21H38N2O/c1-5-6-7-8-9-10-11-12-17-22-18-21(23(2)3)19-13-15-20(24-4)16-14-19/h13-16,21-22H,5-12,17-18H2,1-4H3 |
| InChIKey | YGPIBBWYGIGPQK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|