C28H45ClN2O2 — CID 45262997
N,N'-dihexyl-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine;hydrochloride (PubChem CID 45262997) has the molecular formula C28H45ClN2O2 and a molecular weight of 477.13 g/mol. Its IUPAC name is N,N'-dihexyl-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | N,N'-dihexyl-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 45262997 |
| Molecular Formula | C28H45ClN2O2 |
| Molecular Weight | 477.13 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | N,N'-dihexyl-1,2-bis(4-methoxyphenyl)ethane-1,2-diamine;hydrochloride |
| SMILES | CCCCCCNC(c1ccc(OC)cc1)C(NCCCCCC)c1ccc(OC)cc1.Cl |
| InChI | InChI=1S/C28H44N2O2.ClH/c1-5-7-9-11-21-29-27(23-13-17-25(31-3)18-14-23)28(30-22-12-10-8-6-2)24-15-19-26(32-4)20-16-24;/h13-20,27-30H,5-12,21-22H2,1-4H3;1H |
| InChIKey | PEJZACCWOKBEBH-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.13 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|