C18H31NOS — CID 107763220
1-(4-methoxyphenyl)-2-(3-methylbutan-2-ylsulfanyl)-N-propylpropan-1-amine (PubChem CID 107763220) has the molecular formula C18H31NOS and a molecular weight of 309.52 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-(3-methylbutan-2-ylsulfanyl)-N-propylpropan-1-amine.
| Compound Name | 1-(4-methoxyphenyl)-2-(3-methylbutan-2-ylsulfanyl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 107763220 |
| Molecular Formula | C18H31NOS |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-(3-methylbutan-2-ylsulfanyl)-N-propylpropan-1-amine |
| SMILES | CCCNC(c1ccc(OC)cc1)C(C)SC(C)C(C)C |
| InChI | InChI=1S/C18H31NOS/c1-7-12-19-18(15(5)21-14(4)13(2)3)16-8-10-17(20-6)11-9-16/h8-11,13-15,18-19H,7,12H2,1-6H3 |
| InChIKey | CZQLGEAXUYAZHW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |