C22H30O2S — CID 123815302
1-(5,5-dimethylhexan-3-yl)-4-(1-phenylsulfanyloxyethoxy)benzene (PubChem CID 123815302) has the molecular formula C22H30O2S and a molecular weight of 358.55 g/mol. Its IUPAC name is 1-(5,5-dimethylhexan-3-yl)-4-(1-phenylsulfanyloxyethoxy)benzene.
| Compound Name | 1-(5,5-dimethylhexan-3-yl)-4-(1-phenylsulfanyloxyethoxy)benzene |
|---|---|
| PubChem CID | 123815302 |
| Molecular Formula | C22H30O2S |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 1-(5,5-dimethylhexan-3-yl)-4-(1-phenylsulfanyloxyethoxy)benzene |
| SMILES | CCC(CC(C)(C)C)c1ccc(OC(C)OSc2ccccc2)cc1 |
| InChI | InChI=1S/C22H30O2S/c1-6-18(16-22(3,4)5)19-12-14-20(15-13-19)23-17(2)24-25-21-10-8-7-9-11-21/h7-15,17-18H,6,16H2,1-5H3 |
| InChIKey | XWMNCTHAHQBIOP-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|