C27H46O2 — CID 123451999
1-[(1-methylcyclohexyl)-propan-2-yloxymethoxy]-4-(2,2,5,5-tetramethylhexan-3-yl)benzene (PubChem CID 123451999) has the molecular formula C27H46O2 and a molecular weight of 402.66 g/mol. Its IUPAC name is 1-[(1-methylcyclohexyl)-propan-2-yloxymethoxy]-4-(2,2,5,5-tetramethylhexan-3-yl)benzene.
| Compound Name | 1-[(1-methylcyclohexyl)-propan-2-yloxymethoxy]-4-(2,2,5,5-tetramethylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 123451999 |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.35 |
| IUPAC Name | 1-[(1-methylcyclohexyl)-propan-2-yloxymethoxy]-4-(2,2,5,5-tetramethylhexan-3-yl)benzene |
| SMILES | CC(C)OC(Oc1ccc(C(CC(C)(C)C)C(C)(C)C)cc1)C1(C)CCCCC1 |
| InChI | InChI=1S/C27H46O2/c1-20(2)28-24(27(9)17-11-10-12-18-27)29-22-15-13-21(14-16-22)23(26(6,7)8)19-25(3,4)5/h13-16,20,23-24H,10-12,17-19H2,1-9H3 |
| InChIKey | CYSATLIUUJKCNW-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|