C33H56O2 — CID 123388037
1-(3,3-dicyclohexyl-1-propan-2-yloxypropoxy)-4-(2,2,5-trimethylhexan-3-yl)benzene (PubChem CID 123388037) has the molecular formula C33H56O2 and a molecular weight of 484.81 g/mol. Its IUPAC name is 1-(3,3-dicyclohexyl-1-propan-2-yloxypropoxy)-4-(2,2,5-trimethylhexan-3-yl)benzene.
| Compound Name | 1-(3,3-dicyclohexyl-1-propan-2-yloxypropoxy)-4-(2,2,5-trimethylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 123388037 |
| Molecular Formula | C33H56O2 |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 484.43 |
| IUPAC Name | 1-(3,3-dicyclohexyl-1-propan-2-yloxypropoxy)-4-(2,2,5-trimethylhexan-3-yl)benzene |
| SMILES | CC(C)CC(c1ccc(OC(CC(C2CCCCC2)C2CCCCC2)OC(C)C)cc1)C(C)(C)C |
| InChI | InChI=1S/C33H56O2/c1-24(2)22-31(33(5,6)7)28-18-20-29(21-19-28)35-32(34-25(3)4)23-30(26-14-10-8-11-15-26)27-16-12-9-13-17-27/h18-21,24-27,30-32H,8-17,22-23H2,1-7H3 |
| InChIKey | GTMKCVLHFGKMSD-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|