C30H48O3 — CID 140653868
1-[4-[3,3-dicyclohexyl-1-[(2-methylpropan-2-yl)oxy]propoxy]phenyl]-3-methylbutan-2-one (PubChem CID 140653868) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is 1-[4-[3,3-dicyclohexyl-1-[(2-methylpropan-2-yl)oxy]propoxy]phenyl]-3-methylbutan-2-one.
| Compound Name | 1-[4-[3,3-dicyclohexyl-1-[(2-methylpropan-2-yl)oxy]propoxy]phenyl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 140653868 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | 1-[4-[3,3-dicyclohexyl-1-[(2-methylpropan-2-yl)oxy]propoxy]phenyl]-3-methylbutan-2-one |
| SMILES | CC(C)C(=O)Cc1ccc(OC(CC(C2CCCCC2)C2CCCCC2)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C30H48O3/c1-22(2)28(31)20-23-16-18-26(19-17-23)32-29(33-30(3,4)5)21-27(24-12-8-6-9-13-24)25-14-10-7-11-15-25/h16-19,22,24-25,27,29H,6-15,20-21H2,1-5H3 |
| InChIKey | FUOJNEPSLSGFDP-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|